C10H6ClF6NO3 — CID 102722054
1-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-nitrobenzene (PubChem CID 102722054) has the molecular formula C10H6ClF6NO3 and a molecular weight of 337.60 g/mol. Its IUPAC name is 1-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-nitrobenzene.
| Compound Name | 1-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 102722054 |
| Molecular Formula | C10H6ClF6NO3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(COC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6ClF6NO3/c11-7-2-1-6(18(19)20)3-5(7)4-21-8(9(12,13)14)10(15,16)17/h1-3,8H,4H2 |
| InChIKey | CBCFETOJBLRNKZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|