C15H11ClF5NO3Si — CID 91736361
(2-chloro-5-nitrophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 91736361) has the molecular formula C15H11ClF5NO3Si and a molecular weight of 411.79 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | (2-chloro-5-nitrophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 91736361 |
| Molecular Formula | C15H11ClF5NO3Si |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (2-chloro-5-nitrophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C[Si](C)(OCc1cc([N+](=O)[O-])ccc1Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H11ClF5NO3Si/c1-26(2,15-13(20)11(18)10(17)12(19)14(15)21)25-6-7-5-8(22(23)24)3-4-9(7)16/h3-5H,6H2,1-2H3 |
| InChIKey | WNEXNFTWAJWBJP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|