C22H16N6O12 — CID 91531382
bis[(2,6-dinitrophenyl)methyl] 3,4-diaminobenzene-1,2-dicarboxylate (PubChem CID 91531382) has the molecular formula C22H16N6O12 and a molecular weight of 556.40 g/mol. Its IUPAC name is bis[(2,6-dinitrophenyl)methyl] 3,4-diaminobenzene-1,2-dicarboxylate.
| Compound Name | bis[(2,6-dinitrophenyl)methyl] 3,4-diaminobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91531382 |
| Molecular Formula | C22H16N6O12 |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | bis[(2,6-dinitrophenyl)methyl] 3,4-diaminobenzene-1,2-dicarboxylate |
| SMILES | Nc1ccc(C(=O)OCc2c([N+](=O)[O-])cccc2[N+](=O)[O-])c(C(=O)OCc2c([N+](=O)[O-])cccc2[N+](=O)[O-])c1N |
| InChI | InChI=1S/C22H16N6O12/c23-14-8-7-11(21(29)39-9-12-15(25(31)32)3-1-4-16(12)26(33)34)19(20(14)24)22(30)40-10-13-17(27(35)36)5-2-6-18(13)28(37)38/h1-8H,9-10,23-24H2 |
| InChIKey | BKBSHRWWSYJOCO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 277.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|