C23H16N8O16 — CID 141260841
bis[(2,4,6-trinitrophenyl)methyl] 2-(2,3-diaminophenyl)propanedioate (PubChem CID 141260841) has the molecular formula C23H16N8O16 and a molecular weight of 660.42 g/mol. Its IUPAC name is bis[(2,4,6-trinitrophenyl)methyl] 2-(2,3-diaminophenyl)propanedioate.
| Compound Name | bis[(2,4,6-trinitrophenyl)methyl] 2-(2,3-diaminophenyl)propanedioate |
|---|---|
| PubChem CID | 141260841 |
| Molecular Formula | C23H16N8O16 |
| Molecular Weight | 660.42 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | bis[(2,4,6-trinitrophenyl)methyl] 2-(2,3-diaminophenyl)propanedioate |
| SMILES | Nc1cccc(C(C(=O)OCc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)OCc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c1N |
| InChI | InChI=1S/C23H16N8O16/c24-15-3-1-2-12(21(15)25)20(22(32)46-8-13-16(28(38)39)4-10(26(34)35)5-17(13)29(40)41)23(33)47-9-14-18(30(42)43)6-11(27(36)37)7-19(14)31(44)45/h1-7,20H,8-9,24-25H2 |
| InChIKey | LKXDWTKJGFUTOC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 363.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|