C15H16N6O11 — CID 161328299
2-amino-3,5-dinitrophenol;2-(2-methoxyethoxy)-4,6-dinitroaniline (PubChem CID 161328299) has the molecular formula C15H16N6O11 and a molecular weight of 456.32 g/mol. Its IUPAC name is 2-amino-3,5-dinitrophenol;2-(2-methoxyethoxy)-4,6-dinitroaniline.
| Compound Name | 2-amino-3,5-dinitrophenol;2-(2-methoxyethoxy)-4,6-dinitroaniline |
|---|---|
| PubChem CID | 161328299 |
| Molecular Formula | C15H16N6O11 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-amino-3,5-dinitrophenol;2-(2-methoxyethoxy)-4,6-dinitroaniline |
| SMILES | COCCOc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N.Nc1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O6.C6H5N3O5/c1-17-2-3-18-8-5-6(11(13)14)4-7(9(8)10)12(15)16;7-6-4(9(13)14)1-3(8(11)12)2-5(6)10/h4-5H,2-3,10H2,1H3;1-2,10H,7H2 |
| InChIKey | VLBMXNVCTNQNSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 263.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|