C9H12N2O7S — CID 22766335
2-amino-5-(2-methoxyethoxy)-4-nitrobenzenesulfonic acid (PubChem CID 22766335) has the molecular formula C9H12N2O7S and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-amino-5-(2-methoxyethoxy)-4-nitrobenzenesulfonic acid.
| Compound Name | 2-amino-5-(2-methoxyethoxy)-4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 22766335 |
| Molecular Formula | C9H12N2O7S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-amino-5-(2-methoxyethoxy)-4-nitrobenzenesulfonic acid |
| SMILES | COCCOc1cc(S(=O)(=O)O)c(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N2O7S/c1-17-2-3-18-8-5-9(19(14,15)16)6(10)4-7(8)11(12)13/h4-5H,2-3,10H2,1H3,(H,14,15,16) |
| InChIKey | RPTGXVMGRKQGAM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|