C21H26N2O8 — CID 118029137
1-O-[(2-methyl-6-nitrophenyl)methyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] piperidine-1,4-dicarboxylate (PubChem CID 118029137) has the molecular formula C21H26N2O8 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-O-[(2-methyl-6-nitrophenyl)methyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-[(2-methyl-6-nitrophenyl)methyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118029137 |
| Molecular Formula | C21H26N2O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-O-[(2-methyl-6-nitrophenyl)methyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] piperidine-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CCN(C(=O)OCc2c(C)cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H26N2O8/c1-14(2)19(24)29-11-12-30-20(25)16-7-9-22(10-8-16)21(26)31-13-17-15(3)5-4-6-18(17)23(27)28/h4-6,16H,1,7-13H2,2-3H3 |
| InChIKey | PKZMDJPQSSBITG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|