C29H28N4O8 — CID 163988928
(2-nitrophenyl)methyl N-[4-[[4-[(2-nitrophenyl)methoxycarbonylamino]cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-1,3-dien-1-yl]carbamate (PubChem CID 163988928) has the molecular formula C29H28N4O8 and a molecular weight of 560.56 g/mol. Its IUPAC name is (2-nitrophenyl)methyl N-[4-[[4-[(2-nitrophenyl)methoxycarbonylamino]cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-1,3-dien-1-yl]carbamate.
| Compound Name | (2-nitrophenyl)methyl N-[4-[[4-[(2-nitrophenyl)methoxycarbonylamino]cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-1,3-dien-1-yl]carbamate |
|---|---|
| PubChem CID | 163988928 |
| Molecular Formula | C29H28N4O8 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | (2-nitrophenyl)methyl N-[4-[[4-[(2-nitrophenyl)methoxycarbonylamino]cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-1,3-dien-1-yl]carbamate |
| SMILES | O=C(NC1=CC=C(CC2=CC=C(NC(=O)OCc3ccccc3[N+](=O)[O-])CC2)CC1)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H28N4O8/c34-28(40-18-22-5-1-3-7-26(22)32(36)37)30-24-13-9-20(10-14-24)17-21-11-15-25(16-12-21)31-29(35)41-19-23-6-2-4-8-27(23)33(38)39/h1-9,11,13,15H,10,12,14,16-19H2,(H,30,34)(H,31,35) |
| InChIKey | TYVLGEPQVSJOKO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|