C19H20N2O2S — CID 141034856
tert-butyl N-[2-amino-5-(2-phenylethynylsulfanyl)phenyl]carbamate (PubChem CID 141034856) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-(2-phenylethynylsulfanyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-5-(2-phenylethynylsulfanyl)phenyl]carbamate |
|---|---|
| PubChem CID | 141034856 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | tert-butyl N-[2-amino-5-(2-phenylethynylsulfanyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(SC#Cc2ccccc2)ccc1N |
| InChI | InChI=1S/C19H20N2O2S/c1-19(2,3)23-18(22)21-17-13-15(9-10-16(17)20)24-12-11-14-7-5-4-6-8-14/h4-10,13H,20H2,1-3H3,(H,21,22) |
| InChIKey | WUEPWPDBLSGJOT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|