C25H30N2O5 — CID 70002743
tert-butyl N-[2-amino-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate (PubChem CID 70002743) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 70002743 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl N-[2-amino-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(OCC2COC(C)(C)O2)c(C#Cc2ccccc2)cc1N |
| InChI | InChI=1S/C25H30N2O5/c1-24(2,3)32-23(28)27-21-14-22(29-15-19-16-30-25(4,5)31-19)18(13-20(21)26)12-11-17-9-7-6-8-10-17/h6-10,13-14,19H,15-16,26H2,1-5H3,(H,27,28) |
| InChIKey | IJSWWROTDZSGMC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|