C35H35N3O7 — CID 86758211
tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate (PubChem CID 86758211) has the molecular formula C35H35N3O7 and a molecular weight of 609.68 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86758211 |
| Molecular Formula | C35H35N3O7 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-(2-phenylethynyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(OCC2COC(C)(C)O2)c(C#Cc2ccccc2)cc1NC(=O)CC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C35H35N3O7/c1-34(2,3)45-33(41)38-29-18-31(42-21-27-22-43-35(4,5)44-27)26(15-14-23-10-7-6-8-11-23)17-28(29)37-32(40)19-30(39)25-13-9-12-24(16-25)20-36/h6-13,16-18,27H,19,21-22H2,1-5H3,(H,37,40)(H,38,41) |
| InChIKey | XFOXKDSDXMBORO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|