C33H34FN3O6 — CID 86758265
tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(oxan-2-yloxymethyl)phenyl]carbamate (PubChem CID 86758265) has the molecular formula C33H34FN3O6 and a molecular weight of 587.65 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(oxan-2-yloxymethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(oxan-2-yloxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86758265 |
| Molecular Formula | C33H34FN3O6 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(oxan-2-yloxymethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(COC2CCCCO2)c(-c2ccccc2F)cc1NC(=O)CC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C33H34FN3O6/c1-33(2,3)43-32(40)37-27-16-23(20-42-31-13-6-7-14-41-31)25(24-11-4-5-12-26(24)34)17-28(27)36-30(39)18-29(38)22-10-8-9-21(15-22)19-35/h4-5,8-12,15-17,31H,6-7,13-14,18,20H2,1-3H3,(H,36,39)(H,37,40) |
| InChIKey | DBCJIHSJIIGDPF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|