C26H24FN3O5S — CID 86758247
tert-butyl N-[2-[[3-(5-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-methoxyphenyl]carbamate (PubChem CID 86758247) has the molecular formula C26H24FN3O5S and a molecular weight of 509.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(5-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(5-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 86758247 |
| Molecular Formula | C26H24FN3O5S |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | tert-butyl N-[2-[[3-(5-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-methoxyphenyl]carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2ccc(C#N)s2)cc1-c1ccccc1F |
| InChI | InChI=1S/C26H24FN3O5S/c1-26(2,3)35-25(33)30-20-12-22(34-4)17(16-7-5-6-8-18(16)27)11-19(20)29-24(32)13-21(31)23-10-9-15(14-28)36-23/h5-12H,13H2,1-4H3,(H,29,32)(H,30,33) |
| InChIKey | ONKCKRLOTHLXEY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|