C26H24FN3O6 — CID 86588047
tert-butyl N-[4-(2-fluorophenyl)-2-[[3-(3-nitrophenyl)-3-oxopropanoyl]amino]phenyl]carbamate (PubChem CID 86588047) has the molecular formula C26H24FN3O6 and a molecular weight of 493.49 g/mol. Its IUPAC name is tert-butyl N-[4-(2-fluorophenyl)-2-[[3-(3-nitrophenyl)-3-oxopropanoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-fluorophenyl)-2-[[3-(3-nitrophenyl)-3-oxopropanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 86588047 |
| Molecular Formula | C26H24FN3O6 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | tert-butyl N-[4-(2-fluorophenyl)-2-[[3-(3-nitrophenyl)-3-oxopropanoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccccc2F)cc1NC(=O)CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24FN3O6/c1-26(2,3)36-25(33)29-21-12-11-16(19-9-4-5-10-20(19)27)14-22(21)28-24(32)15-23(31)17-7-6-8-18(13-17)30(34)35/h4-14H,15H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | DEAZCTMCBBTQET-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|