C30H28FN3O5 — CID 91277684
tert-butyl N-[2-(4-fluorophenyl)-6-[[3-[3-(3-methyl-1,2-oxazol-5-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamate (PubChem CID 91277684) has the molecular formula C30H28FN3O5 and a molecular weight of 529.57 g/mol. Its IUPAC name is tert-butyl N-[2-(4-fluorophenyl)-6-[[3-[3-(3-methyl-1,2-oxazol-5-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-fluorophenyl)-6-[[3-[3-(3-methyl-1,2-oxazol-5-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 91277684 |
| Molecular Formula | C30H28FN3O5 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | tert-butyl N-[2-(4-fluorophenyl)-6-[[3-[3-(3-methyl-1,2-oxazol-5-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamate |
| SMILES | Cc1cc(-c2cccc(C(=O)CC(=O)Nc3cccc(-c4ccc(F)cc4)c3NC(=O)OC(C)(C)C)c2)on1 |
| InChI | InChI=1S/C30H28FN3O5/c1-18-15-26(39-34-18)21-8-5-7-20(16-21)25(35)17-27(36)32-24-10-6-9-23(19-11-13-22(31)14-12-19)28(24)33-29(37)38-30(2,3)4/h5-16H,17H2,1-4H3,(H,32,36)(H,33,37) |
| InChIKey | HJKFQCAMBYWTSQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|