C26H21FN4O4 — CID 22224856
[4-(2-fluorophenyl)-2-[[3-[3-(2-methylimidazol-1-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid (PubChem CID 22224856) has the molecular formula C26H21FN4O4 and a molecular weight of 472.48 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-2-[[3-[3-(2-methylimidazol-1-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid.
| Compound Name | [4-(2-fluorophenyl)-2-[[3-[3-(2-methylimidazol-1-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 22224856 |
| Molecular Formula | C26H21FN4O4 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [4-(2-fluorophenyl)-2-[[3-[3-(2-methylimidazol-1-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid |
| SMILES | Cc1nccn1-c1cccc(C(=O)CC(=O)Nc2cc(-c3ccccc3F)ccc2NC(=O)O)c1 |
| InChI | InChI=1S/C26H21FN4O4/c1-16-28-11-12-31(16)19-6-4-5-18(13-19)24(32)15-25(33)29-23-14-17(9-10-22(23)30-26(34)35)20-7-2-3-8-21(20)27/h2-14,30H,15H2,1H3,(H,29,33)(H,34,35) |
| InChIKey | KOADAMXWWYCYLC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|