C21H14FN3O4S — CID 22224840
[2-[[3-(3-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)phenyl]carbamic acid (PubChem CID 22224840) has the molecular formula C21H14FN3O4S and a molecular weight of 423.43 g/mol. Its IUPAC name is [2-[[3-(3-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22224840 |
| Molecular Formula | C21H14FN3O4S |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [2-[[3-(3-cyanothiophen-2-yl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)phenyl]carbamic acid |
| SMILES | N#Cc1ccsc1C(=O)CC(=O)Nc1cc(-c2ccccc2F)ccc1NC(=O)O |
| InChI | InChI=1S/C21H14FN3O4S/c22-15-4-2-1-3-14(15)12-5-6-16(25-21(28)29)17(9-12)24-19(27)10-18(26)20-13(11-23)7-8-30-20/h1-9,25H,10H2,(H,24,27)(H,28,29) |
| InChIKey | FCLQNZCXYABTMY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|