C25H15F2N3O4 — CID 152753066
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-[2-(2,4-difluorophenyl)ethynyl]phenyl]carbamic acid (PubChem CID 152753066) has the molecular formula C25H15F2N3O4 and a molecular weight of 459.41 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-[2-(2,4-difluorophenyl)ethynyl]phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-[2-(2,4-difluorophenyl)ethynyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 152753066 |
| Molecular Formula | C25H15F2N3O4 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-[2-(2,4-difluorophenyl)ethynyl]phenyl]carbamic acid |
| SMILES | N#Cc1cccc(C(=O)CC(=O)Nc2cc(C#Cc3ccc(F)cc3F)ccc2NC(=O)O)c1 |
| InChI | InChI=1S/C25H15F2N3O4/c26-19-8-7-17(20(27)12-19)6-4-15-5-9-21(30-25(33)34)22(11-15)29-24(32)13-23(31)18-3-1-2-16(10-18)14-28/h1-3,5,7-12,30H,13H2,(H,29,32)(H,33,34) |
| InChIKey | BUILEJDCSCFRRA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|