C22H18N4O5 — CID 18548918
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-methoxy-4-pyrrol-1-ylphenyl]carbamic acid (PubChem CID 18548918) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-methoxy-4-pyrrol-1-ylphenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-methoxy-4-pyrrol-1-ylphenyl]carbamic acid |
|---|---|
| PubChem CID | 18548918 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-methoxy-4-pyrrol-1-ylphenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(C#N)c2)cc1-n1cccc1 |
| InChI | InChI=1S/C22H18N4O5/c1-31-20-11-17(25-22(29)30)16(10-18(20)26-7-2-3-8-26)24-21(28)12-19(27)15-6-4-5-14(9-15)13-23/h2-11,25H,12H2,1H3,(H,24,28)(H,29,30) |
| InChIKey | VCCWDNIONLSXEK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|