C23H16FN3O4 — CID 22224573
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(3-fluorophenyl)phenyl]carbamic acid (PubChem CID 22224573) has the molecular formula C23H16FN3O4 and a molecular weight of 417.40 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(3-fluorophenyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(3-fluorophenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22224573 |
| Molecular Formula | C23H16FN3O4 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(3-fluorophenyl)phenyl]carbamic acid |
| SMILES | N#Cc1cccc(C(=O)CC(=O)Nc2cc(-c3cccc(F)c3)ccc2NC(=O)O)c1 |
| InChI | InChI=1S/C23H16FN3O4/c24-18-6-2-4-15(10-18)16-7-8-19(27-23(30)31)20(11-16)26-22(29)12-21(28)17-5-1-3-14(9-17)13-25/h1-11,27H,12H2,(H,26,29)(H,30,31) |
| InChIKey | ZDTWODCVIPTBTF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|