C34H34N4O6 — CID 86758213
tert-butyl N-[2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate (PubChem CID 86758213) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86758213 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-n3ccnc3)c2)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C34H34N4O6/c1-34(2,3)44-33(41)37-29-21-31(43-18-17-42-4)26(14-13-24-9-6-5-7-10-24)20-28(29)36-32(40)22-30(39)25-11-8-12-27(19-25)38-16-15-35-23-38/h5-12,15-16,19-21,23H,17-18,22H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | LGAHKULBEBONIS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|