C24H18N4O — CID 158569619
2-(3-imidazol-1-ylphenyl)-1-[3-[2-(4-methylpyrimidin-5-yl)ethynyl]phenyl]ethanone (PubChem CID 158569619) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylphenyl)-1-[3-[2-(4-methylpyrimidin-5-yl)ethynyl]phenyl]ethanone.
| Compound Name | 2-(3-imidazol-1-ylphenyl)-1-[3-[2-(4-methylpyrimidin-5-yl)ethynyl]phenyl]ethanone |
|---|---|
| PubChem CID | 158569619 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-(3-imidazol-1-ylphenyl)-1-[3-[2-(4-methylpyrimidin-5-yl)ethynyl]phenyl]ethanone |
| SMILES | Cc1ncncc1C#Cc1cccc(C(=O)Cc2cccc(-n3ccnc3)c2)c1 |
| InChI | InChI=1S/C24H18N4O/c1-18-22(15-26-16-27-18)9-8-19-4-2-6-21(12-19)24(29)14-20-5-3-7-23(13-20)28-11-10-25-17-28/h2-7,10-13,15-17H,14H2,1H3 |
| InChIKey | UXNCWZHUUDCHCH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|