C25H25N3O — CID 158711828
1-[3-[2-(azepan-3-yl)ethynyl]phenyl]-2-(3-imidazol-1-ylphenyl)ethanone (PubChem CID 158711828) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[3-[2-(azepan-3-yl)ethynyl]phenyl]-2-(3-imidazol-1-ylphenyl)ethanone.
| Compound Name | 1-[3-[2-(azepan-3-yl)ethynyl]phenyl]-2-(3-imidazol-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 158711828 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[3-[2-(azepan-3-yl)ethynyl]phenyl]-2-(3-imidazol-1-ylphenyl)ethanone |
| SMILES | O=C(Cc1cccc(-n2ccnc2)c1)c1cccc(C#CC2CCCCNC2)c1 |
| InChI | InChI=1S/C25H25N3O/c29-25(17-22-7-4-9-24(16-22)28-14-13-27-19-28)23-8-3-6-20(15-23)10-11-21-5-1-2-12-26-18-21/h3-4,6-9,13-16,19,21,26H,1-2,5,12,17-18H2 |
| InChIKey | DAMBNGWBHGCGEG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|