C13H14ClN — CID 141169044
3-[2-(3-chlorophenyl)ethynyl]piperidine (PubChem CID 141169044) has the molecular formula C13H14ClN and a molecular weight of 219.72 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethynyl]piperidine.
| Compound Name | 3-[2-(3-chlorophenyl)ethynyl]piperidine |
|---|---|
| PubChem CID | 141169044 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethynyl]piperidine |
| SMILES | Clc1cccc(C#CC2CCCNC2)c1 |
| InChI | InChI=1S/C13H14ClN/c14-13-5-1-3-11(9-13)6-7-12-4-2-8-15-10-12/h1,3,5,9,12,15H,2,4,8,10H2 |
| InChIKey | RJEGGTZBHZWXHH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|