C27H36N4O7 — CID 142394012
tert-butyl N-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-formylpyrimidin-4-yl]-N-(4-methylphenyl)carbamate (PubChem CID 142394012) has the molecular formula C27H36N4O7 and a molecular weight of 528.61 g/mol. Its IUPAC name is tert-butyl N-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-formylpyrimidin-4-yl]-N-(4-methylphenyl)carbamate.
| Compound Name | tert-butyl N-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-formylpyrimidin-4-yl]-N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 142394012 |
| Molecular Formula | C27H36N4O7 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | tert-butyl N-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-formylpyrimidin-4-yl]-N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(N(C(=O)OC(C)(C)C)c2cc(C=O)nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C27H36N4O7/c1-17-11-13-19(14-12-17)30(22(33)36-25(2,3)4)20-15-18(16-32)28-21(29-20)31(23(34)37-26(5,6)7)24(35)38-27(8,9)10/h11-16H,1-10H3 |
| InChIKey | BLNBZQWMSJDYRP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 128.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|