C34H38N4O4 — CID 142297581
tert-butyl N-[4-[4-[4-amino-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]phenyl]phenyl]-N-(4-aminophenyl)carbamate (PubChem CID 142297581) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[4-amino-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]phenyl]phenyl]-N-(4-aminophenyl)carbamate.
| Compound Name | tert-butyl N-[4-[4-[4-amino-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]phenyl]phenyl]-N-(4-aminophenyl)carbamate |
|---|---|
| PubChem CID | 142297581 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | tert-butyl N-[4-[4-[4-amino-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]phenyl]phenyl]-N-(4-aminophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(N)cc1)c1ccc(-c2ccc(N(C(=O)OC(C)(C)C)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H38N4O4/c1-33(2,3)41-31(39)37(29-19-11-25(35)12-20-29)27-15-7-23(8-16-27)24-9-17-28(18-10-24)38(32(40)42-34(4,5)6)30-21-13-26(36)14-22-30/h7-22H,35-36H2,1-6H3 |
| InChIKey | MXZLDHKIDSDKPC-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|