C21H25NO4 — CID 141179475
methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylanilino]propanoate (PubChem CID 141179475) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylanilino]propanoate.
| Compound Name | methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylanilino]propanoate |
|---|---|
| PubChem CID | 141179475 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylanilino]propanoate |
| SMILES | COC(=O)C(C)N(C(=O)OC(C)(C)C)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H25NO4/c1-15(19(23)25-5)22(20(24)26-21(2,3)4)18-14-10-9-13-17(18)16-11-7-6-8-12-16/h6-15H,1-5H3 |
| InChIKey | XZZGNRFPOGOVMY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |