C22H26O4 — CID 67208834
4-O-tert-butyl 1-O-methyl 2-[(2-phenylphenyl)methyl]butanedioate (PubChem CID 67208834) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-[(2-phenylphenyl)methyl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-[(2-phenylphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 67208834 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-[(2-phenylphenyl)methyl]butanedioate |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H26O4/c1-22(2,3)26-20(23)15-18(21(24)25-4)14-17-12-8-9-13-19(17)16-10-6-5-7-11-16/h5-13,18H,14-15H2,1-4H3 |
| InChIKey | XHESSPQGKZJBCR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |