C31H31NO3 — CID 69463579
1,1'-biphenyl;(2S)-2-[N-(2-methylpropanoyl)-2-phenylanilino]propanoic acid (PubChem CID 69463579) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is 1,1'-biphenyl;(2S)-2-[N-(2-methylpropanoyl)-2-phenylanilino]propanoic acid.
| Compound Name | 1,1'-biphenyl;(2S)-2-[N-(2-methylpropanoyl)-2-phenylanilino]propanoic acid |
|---|---|
| PubChem CID | 69463579 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1,1'-biphenyl;(2S)-2-[N-(2-methylpropanoyl)-2-phenylanilino]propanoic acid |
| SMILES | CC(C)C(=O)N(c1ccccc1-c1ccccc1)[C@@H](C)C(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3.C12H10/c1-13(2)18(21)20(14(3)19(22)23)17-12-8-7-11-16(17)15-9-5-4-6-10-15;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h4-14H,1-3H3,(H,22,23);1-10H/t14-;/m0./s1 |
| InChIKey | CNUNSNIWNDIKEC-UQKRIMTDSA-N |
| XLogP | 7.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |