C14H18N2 — CID 162317872
azane;N,N-dimethyl-2-phenylaniline (PubChem CID 162317872) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is azane;N,N-dimethyl-2-phenylaniline.
| Compound Name | azane;N,N-dimethyl-2-phenylaniline |
|---|---|
| PubChem CID | 162317872 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | azane;N,N-dimethyl-2-phenylaniline |
| SMILES | CN(C)c1ccccc1-c1ccccc1.N |
| InChI | InChI=1S/C14H15N.H3N/c1-15(2)14-11-7-6-10-13(14)12-8-4-3-5-9-12;/h3-11H,1-2H3;1H3 |
| InChIKey | SMFCCSMHCHONRN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |