C14H17N2Na — CID 174417250
sodium;1-N,1-N-dimethyl-3-phenylbenzene-1,2-diamine;hydride (PubChem CID 174417250) has the molecular formula C14H17N2Na and a molecular weight of 236.29 g/mol. Its IUPAC name is sodium;1-N,1-N-dimethyl-3-phenylbenzene-1,2-diamine;hydride.
| Compound Name | sodium;1-N,1-N-dimethyl-3-phenylbenzene-1,2-diamine;hydride |
|---|---|
| PubChem CID | 174417250 |
| Molecular Formula | C14H17N2Na |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | sodium;1-N,1-N-dimethyl-3-phenylbenzene-1,2-diamine;hydride |
| SMILES | CN(C)c1cccc(-c2ccccc2)c1N.[H-].[Na+] |
| InChI | InChI=1S/C14H16N2.Na.H/c1-16(2)13-10-6-9-12(14(13)15)11-7-4-3-5-8-11;;/h3-10H,15H2,1-2H3;;/q;+1;-1 |
| InChIKey | SJWBPZJJGMFYAC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|