C20H19N — CID 54080390
N,2-dimethyl-N,3-diphenylaniline (PubChem CID 54080390) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is N,2-dimethyl-N,3-diphenylaniline.
| Compound Name | N,2-dimethyl-N,3-diphenylaniline |
|---|---|
| PubChem CID | 54080390 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N,2-dimethyl-N,3-diphenylaniline |
| SMILES | Cc1c(-c2ccccc2)cccc1N(C)c1ccccc1 |
| InChI | InChI=1S/C20H19N/c1-16-19(17-10-5-3-6-11-17)14-9-15-20(16)21(2)18-12-7-4-8-13-18/h3-15H,1-2H3 |
| InChIKey | MMRMDGHCNJTCMV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |