C20H17NO — CID 15090544
2-(N-methylanilino)-7-phenylcyclohepta-2,4,6-trien-1-one (PubChem CID 15090544) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(N-methylanilino)-7-phenylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-(N-methylanilino)-7-phenylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 15090544 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(N-methylanilino)-7-phenylcyclohepta-2,4,6-trien-1-one |
| SMILES | CN(c1ccccc1)c1ccccc(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H17NO/c1-21(17-12-6-3-7-13-17)19-15-9-8-14-18(20(19)22)16-10-4-2-5-11-16/h2-15H,1H3 |
| InChIKey | KLXPUYYPYMZWLF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |