C18H20FNO2 — CID 141179490
ethyl (2S)-2-[N-(fluoromethyl)-2-phenylanilino]propanoate (PubChem CID 141179490) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is ethyl (2S)-2-[N-(fluoromethyl)-2-phenylanilino]propanoate.
| Compound Name | ethyl (2S)-2-[N-(fluoromethyl)-2-phenylanilino]propanoate |
|---|---|
| PubChem CID | 141179490 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl (2S)-2-[N-(fluoromethyl)-2-phenylanilino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N(CF)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H20FNO2/c1-3-22-18(21)14(2)20(13-19)17-12-8-7-11-16(17)15-9-5-4-6-10-15/h4-12,14H,3,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | OTFMLGFGSYFYAO-AWEZNQCLSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|