C26H35NO4 — CID 141179469
ethyl (2S)-2-[2-(4-butylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoate (PubChem CID 141179469) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is ethyl (2S)-2-[2-(4-butylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoate.
| Compound Name | ethyl (2S)-2-[2-(4-butylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoate |
|---|---|
| PubChem CID | 141179469 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | ethyl (2S)-2-[2-(4-butylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoate |
| SMILES | CCCCc1ccc(-c2ccccc2N(C(=O)OC(C)(C)C)[C@@H](C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-7-9-12-20-15-17-21(18-16-20)22-13-10-11-14-23(22)27(19(3)24(28)30-8-2)25(29)31-26(4,5)6/h10-11,13-19H,7-9,12H2,1-6H3/t19-/m0/s1 |
| InChIKey | FQJQLLODFHIHFM-IBGZPJMESA-N |
| XLogP | 6.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |