C11H12Cl3NO3 — CID 70542986
(2S)-2-(N-(2,2-dichloroacetyl)anilino)propanoic acid;hydrochloride (PubChem CID 70542986) has the molecular formula C11H12Cl3NO3 and a molecular weight of 312.58 g/mol. Its IUPAC name is (2S)-2-(N-(2,2-dichloroacetyl)anilino)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-(N-(2,2-dichloroacetyl)anilino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70542986 |
| Molecular Formula | C11H12Cl3NO3 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | (2S)-2-(N-(2,2-dichloroacetyl)anilino)propanoic acid;hydrochloride |
| SMILES | C[C@@H](C(=O)O)N(C(=O)C(Cl)Cl)c1ccccc1.Cl |
| InChI | InChI=1S/C11H11Cl2NO3.ClH/c1-7(11(16)17)14(10(15)9(12)13)8-5-3-2-4-6-8;/h2-7,9H,1H3,(H,16,17);1H/t7-;/m0./s1 |
| InChIKey | TUGSMCHMOOATSY-FJXQXJEOSA-N |
| XLogP | 2.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|