C13H15NO3 — CID 15339252
N-(3,4-dioxopentan-2-yl)-N-phenylacetamide (PubChem CID 15339252) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(3,4-dioxopentan-2-yl)-N-phenylacetamide.
| Compound Name | N-(3,4-dioxopentan-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 15339252 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(3,4-dioxopentan-2-yl)-N-phenylacetamide |
| SMILES | CC(=O)C(=O)C(C)N(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-9(13(17)10(2)15)14(11(3)16)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | IMLNLVVTUHDQSN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|