About S-prop-2-enyl 2-(N-acetylanilino)propanethioate
S-prop-2-enyl 2-(N-acetylanilino)propanethioate (PubChem CID 88698684) has the molecular formula C14H17NO2S
and a molecular weight of 263.36 g/mol. Its IUPAC name is S-prop-2-enyl 2-(N-acetylanilino)propanethioate.
Molecular Properties
| Compound Name | S-prop-2-enyl 2-(N-acetylanilino)propanethioate |
| PubChem CID | 88698684 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | S-prop-2-enyl 2-(N-acetylanilino)propanethioate |
| SMILES | C=CCSC(=O)C(C)N(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO2S/c1-4-10-18-14(17)11(2)15(12(3)16)13-8-6-5-7-9-13/h4-9,11H,1,10H2,2-3H3 |
| InChIKey | PWPCTMLOEBEVOW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl 2-(N-acetylanilino)propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl 2-(N-acetylanilino)propanethioate?
The IUPAC name of S-prop-2-enyl 2-(N-acetylanilino)propanethioate (CID 88698684) is S-prop-2-enyl 2-(N-acetylanilino)propanethioate.
What is the SMILES notation for S-prop-2-enyl 2-(N-acetylanilino)propanethioate?
The canonical SMILES for S-prop-2-enyl 2-(N-acetylanilino)propanethioate is C=CCSC(=O)C(C)N(C(C)=O)c1ccccc1.
What is the InChIKey of S-prop-2-enyl 2-(N-acetylanilino)propanethioate?
The InChIKey is PWPCTMLOEBEVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2S/c1-4-10-18-14(17)11(2)15(12(3)16)13-8-6-5-7-9-13/h4-9,11H,1,10H2,2-3H3.
What are the key properties of S-prop-2-enyl 2-(N-acetylanilino)propanethioate?
S-prop-2-enyl 2-(N-acetylanilino)propanethioate has a molecular weight of 263.36 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl 2-(N-acetylanilino)propanethioate is sourced from PubChem (CID 88698684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).