C18H25NO5S — CID 88771555
2-methyl-3-[(2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoyl]sulfanylpropanoic acid (PubChem CID 88771555) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-methyl-3-[(2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-3-[(2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88771555 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-methyl-3-[(2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoyl]sulfanylpropanoic acid |
| SMILES | CC(CSC(=O)[C@H](C)N(C(=O)OC(C)(C)C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H25NO5S/c1-12(15(20)21)11-25-16(22)13(2)19(14-9-7-6-8-10-14)17(23)24-18(3,4)5/h6-10,12-13H,11H2,1-5H3,(H,20,21)/t12?,13-/m0/s1 |
| InChIKey | OYMNCTKYYISOKT-ABLWVSNPSA-N |
| XLogP | 3.80 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|