C14H20N2O4 — CID 141179557
methyl (2S)-2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]propanoate (PubChem CID 141179557) has the molecular formula C14H20N2O4 and a molecular weight of 281.33 g/mol. Its IUPAC name is methyl (2S)-2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]propanoate.
| Compound Name | methyl (2S)-2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 141179557 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | methyl (2S)-2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]propanoate |
| SMILES | [2H]CC(C)(C)OC(=O)N(c1ccccn1)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H20N2O4/c1-10(12(17)19-5)16(11-8-6-7-9-15-11)13(18)20-14(2,3)4/h6-10H,1-5H3/t10-/m0/s1/i2D |
| InChIKey | VCXOYZGITQLTKD-HZQQZBLJSA-N |
| XLogP | 2.38 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |