C16H24N2O3 — CID 123588396
tert-butyl N-(5-oxohexyl)-N-pyridin-2-ylcarbamate (PubChem CID 123588396) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl N-(5-oxohexyl)-N-pyridin-2-ylcarbamate.
| Compound Name | tert-butyl N-(5-oxohexyl)-N-pyridin-2-ylcarbamate |
|---|---|
| PubChem CID | 123588396 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl N-(5-oxohexyl)-N-pyridin-2-ylcarbamate |
| SMILES | CC(=O)CCCCN(C(=O)OC(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C16H24N2O3/c1-13(19)9-6-8-12-18(14-10-5-7-11-17-14)15(20)21-16(2,3)4/h5,7,10-11H,6,8-9,12H2,1-4H3 |
| InChIKey | WQECETUYYYMJMP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|