C19H24N6O2 — CID 58230701
tert-butyl N-[6-(2-azidoethyl)-2-pyridinyl]-N-(2-pyridin-2-ylethyl)carbamate (PubChem CID 58230701) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl N-[6-(2-azidoethyl)-2-pyridinyl]-N-(2-pyridin-2-ylethyl)carbamate.
| Compound Name | tert-butyl N-[6-(2-azidoethyl)-2-pyridinyl]-N-(2-pyridin-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 58230701 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | tert-butyl N-[6-(2-azidoethyl)-2-pyridinyl]-N-(2-pyridin-2-ylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccccn1)c1cccc(CCN=[N+]=[N-])n1 |
| InChI | InChI=1S/C19H24N6O2/c1-19(2,3)27-18(26)25(14-11-15-7-4-5-12-21-15)17-9-6-8-16(23-17)10-13-22-24-20/h4-9,12H,10-11,13-14H2,1-3H3 |
| InChIKey | HAWLKFQSPDRMFM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|