C17H22N4O4S — CID 57057466
[5-[4-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]butyl]-1,3,4-thiadiazol-2-yl] formate (PubChem CID 57057466) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is [5-[4-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]butyl]-1,3,4-thiadiazol-2-yl] formate.
| Compound Name | [5-[4-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]butyl]-1,3,4-thiadiazol-2-yl] formate |
|---|---|
| PubChem CID | 57057466 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [5-[4-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]butyl]-1,3,4-thiadiazol-2-yl] formate |
| SMILES | CC(C)(C)OC(=O)N(CCCCc1nnc(OC=O)s1)c1ccccn1 |
| InChI | InChI=1S/C17H22N4O4S/c1-17(2,3)25-16(23)21(13-8-4-6-10-18-13)11-7-5-9-14-19-20-15(26-14)24-12-22/h4,6,8,10,12H,5,7,9,11H2,1-3H3 |
| InChIKey | ONUYGVUTZZRSQD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|