C22H28N4O4 — CID 22499456
tert-butyl N-[2-oxo-2-(4-pyridin-2-yloxypiperidin-1-yl)ethyl]-N-pyridin-2-ylcarbamate (PubChem CID 22499456) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-(4-pyridin-2-yloxypiperidin-1-yl)ethyl]-N-pyridin-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-oxo-2-(4-pyridin-2-yloxypiperidin-1-yl)ethyl]-N-pyridin-2-ylcarbamate |
|---|---|
| PubChem CID | 22499456 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | tert-butyl N-[2-oxo-2-(4-pyridin-2-yloxypiperidin-1-yl)ethyl]-N-pyridin-2-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)N1CCC(Oc2ccccn2)CC1)c1ccccn1 |
| InChI | InChI=1S/C22H28N4O4/c1-22(2,3)30-21(28)26(18-8-4-6-12-23-18)16-20(27)25-14-10-17(11-15-25)29-19-9-5-7-13-24-19/h4-9,12-13,17H,10-11,14-16H2,1-3H3 |
| InChIKey | WIBJRANHEKOUNF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |