C23H30N4O3 — CID 22499476
tert-butyl N-[2-oxo-2-[4-(pyridin-3-ylamino)piperidin-1-yl]ethyl]-N-phenylcarbamate (PubChem CID 22499476) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[4-(pyridin-3-ylamino)piperidin-1-yl]ethyl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[4-(pyridin-3-ylamino)piperidin-1-yl]ethyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 22499476 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[4-(pyridin-3-ylamino)piperidin-1-yl]ethyl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)N1CCC(Nc2cccnc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,3)30-22(29)27(20-9-5-4-6-10-20)17-21(28)26-14-11-18(12-15-26)25-19-8-7-13-24-16-19/h4-10,13,16,18,25H,11-12,14-15,17H2,1-3H3 |
| InChIKey | BUYHTLFUNXEYMG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |