About 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate
4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate (PubChem CID 10425319) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate |
| PubChem CID | 10425319 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate |
| SMILES | COC(=O)[C@@H](C)C(C(=O)OC(C)(C)C)C(=O)c1ccccn1 |
| InChI | InChI=1S/C16H21NO5/c1-10(14(19)21-5)12(15(20)22-16(2,3)4)13(18)11-8-6-7-9-17-11/h6-10,12H,1-5H3/t10-,12?/m0/s1 |
| InChIKey | QJURELMGBFBQCC-NUHJPDEHSA-N |
| XLogP | 2.03 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate (CID 10425319) is 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate is COC(=O)[C@@H](C)C(C(=O)OC(C)(C)C)C(=O)c1ccccn1.
What is the InChIKey of 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate?
The InChIKey is QJURELMGBFBQCC-NUHJPDEHSA-N. The full InChI is InChI=1S/C16H21NO5/c1-10(14(19)21-5)12(15(20)22-16(2,3)4)13(18)11-8-6-7-9-17-11/h6-10,12H,1-5H3/t10-,12?/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate?
4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate has a molecular weight of 307.35 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-methyl (2S)-2-methyl-3-(pyridine-2-carbonyl)butanedioate is sourced from PubChem (CID 10425319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).