C10H15N3O — CID 61265385
2-amino-N,2-dimethyl-N-pyridin-2-ylpropanamide (PubChem CID 61265385) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-amino-N,2-dimethyl-N-pyridin-2-ylpropanamide.
| Compound Name | 2-amino-N,2-dimethyl-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 61265385 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-amino-N,2-dimethyl-N-pyridin-2-ylpropanamide |
| SMILES | CN(C(=O)C(C)(C)N)c1ccccn1 |
| InChI | InChI=1S/C10H15N3O/c1-10(2,11)9(14)13(3)8-6-4-5-7-12-8/h4-7H,11H2,1-3H3 |
| InChIKey | JYGLLDJLOGNDJY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |