C8H8F2N2O — CID 103515256
2,2-difluoro-N-methyl-N-pyridin-2-ylacetamide (PubChem CID 103515256) has the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-N-pyridin-2-ylacetamide.
| Compound Name | 2,2-difluoro-N-methyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 103515256 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2,2-difluoro-N-methyl-N-pyridin-2-ylacetamide |
| SMILES | CN(C(=O)C(F)F)c1ccccn1 |
| InChI | InChI=1S/C8H8F2N2O/c1-12(8(13)7(9)10)6-4-2-3-5-11-6/h2-5,7H,1H3 |
| InChIKey | YRPGJEGJCCUHRJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |