C13H18N2O — CID 124618003
(2S)-N,2,4-trimethyl-N-pyridin-2-ylpent-4-enamide (PubChem CID 124618003) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S)-N,2,4-trimethyl-N-pyridin-2-ylpent-4-enamide.
| Compound Name | (2S)-N,2,4-trimethyl-N-pyridin-2-ylpent-4-enamide |
|---|---|
| PubChem CID | 124618003 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (2S)-N,2,4-trimethyl-N-pyridin-2-ylpent-4-enamide |
| SMILES | C=C(C)C[C@H](C)C(=O)N(C)c1ccccn1 |
| InChI | InChI=1S/C13H18N2O/c1-10(2)9-11(3)13(16)15(4)12-7-5-6-8-14-12/h5-8,11H,1,9H2,2-4H3/t11-/m0/s1 |
| InChIKey | AGDOCZDRCXKJCD-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|