C10H12N4O2S — CID 43316407
N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-pyridin-2-yloxamide (PubChem CID 43316407) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-pyridin-2-yloxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 43316407 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-pyridin-2-yloxamide |
| SMILES | CN(C(=O)C(=O)NCC(N)=S)c1ccccn1 |
| InChI | InChI=1S/C10H12N4O2S/c1-14(8-4-2-3-5-12-8)10(16)9(15)13-6-7(11)17/h2-5H,6H2,1H3,(H2,11,17)(H,13,15) |
| InChIKey | CKBZBTZQYWACJT-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|